C6H13NOS — CID 163989388
(1S)-1-[(5S)-5-methyl-1,3-thiazolidin-3-yl]ethanol (PubChem CID 163989388) has the molecular formula C6H13NOS and a molecular weight of 147.24 g/mol. Its IUPAC name is (1S)-1-[(5S)-5-methyl-1,3-thiazolidin-3-yl]ethanol.
| Compound Name | (1S)-1-[(5S)-5-methyl-1,3-thiazolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 163989388 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (1S)-1-[(5S)-5-methyl-1,3-thiazolidin-3-yl]ethanol |
| SMILES | C[C@H](O)N1CS[C@@H](C)C1 |
| InChI | InChI=1S/C6H13NOS/c1-5-3-7(4-9-5)6(2)8/h5-6,8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | TZGHHRPKBILWJD-WDSKDSINSA-N |
| XLogP | 0.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |