C20H21N5O2S — CID 163993644
2-[[4-ethyl-5-(1H-indol-3-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzeneamine oxide (PubChem CID 163993644) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(1H-indol-3-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[[4-ethyl-5-(1H-indol-3-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163993644 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-[[4-ethyl-5-(1H-indol-3-ylmethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-N-hydroxybenzeneamine oxide |
| SMILES | CCn1c(Cc2c[nH]c3ccccc23)nnc1SCc1ccccc1[NH+]([O-])O |
| InChI | InChI=1S/C20H21N5O2S/c1-2-24-19(11-15-12-21-17-9-5-4-8-16(15)17)22-23-20(24)28-13-14-7-3-6-10-18(14)25(26)27/h3-10,12,21,25-26H,2,11,13H2,1H3 |
| InChIKey | UCTZWPQTSIAHPY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|