C7H15N3O — CID 163994058
(2S)-2,6-dimethylmorpholine-4-carboximidamide (PubChem CID 163994058) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is (2S)-2,6-dimethylmorpholine-4-carboximidamide.
| Compound Name | (2S)-2,6-dimethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 163994058 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | (2S)-2,6-dimethylmorpholine-4-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC(C)O[C@@H](C)C1 |
| InChI | InChI=1S/C7H15N3O/c1-5-3-10(7(8)9)4-6(2)11-5/h5-6H,3-4H2,1-2H3,(H3,8,9)/t5-,6?/m0/s1 |
| InChIKey | UDDVOGZLLZURDK-ZBHICJROSA-N |
| XLogP | -0.01 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|