C13H23NO3 — CID 163994359
tert-butyl N-methyl-N-(5-methyl-3-oxohex-4-en-2-yl)carbamate (PubChem CID 163994359) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(5-methyl-3-oxohex-4-en-2-yl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(5-methyl-3-oxohex-4-en-2-yl)carbamate |
|---|---|
| PubChem CID | 163994359 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | tert-butyl N-methyl-N-(5-methyl-3-oxohex-4-en-2-yl)carbamate |
| SMILES | CC(C)=CC(=O)C(C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO3/c1-9(2)8-11(15)10(3)14(7)12(16)17-13(4,5)6/h8,10H,1-7H3 |
| InChIKey | UDJZSHWHYGUULZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|