About tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate
tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate (PubChem CID 167721148) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate.
Analyze tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate?
The IUPAC name of tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate (CID 167721148) is tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate.
What is the SMILES notation for tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate?
The canonical SMILES for tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate is CC(N(C)C(=O)OC(C)(C)C)C(F)(F)F.
What is the InChIKey of tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate?
The InChIKey is HJTDIGDHFKIHKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c1-6(9(10,11)12)13(5)7(14)15-8(2,3)4/h6H,1-5H3.
What are the key properties of tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate?
tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate has a molecular weight of 227.23 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methyl-N-(1,1,1-trifluoropropan-2-yl)carbamate is sourced from PubChem (CID 167721148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).