C9H15F2NO3 — CID 84725208
tert-butyl N-(1,1-difluoro-3-oxopropan-2-yl)-N-methylcarbamate (PubChem CID 84725208) has the molecular formula C9H15F2NO3 and a molecular weight of 223.22 g/mol. Its IUPAC name is tert-butyl N-(1,1-difluoro-3-oxopropan-2-yl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(1,1-difluoro-3-oxopropan-2-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 84725208 |
| Molecular Formula | C9H15F2NO3 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | tert-butyl N-(1,1-difluoro-3-oxopropan-2-yl)-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(C=O)C(F)F |
| InChI | InChI=1S/C9H15F2NO3/c1-9(2,3)15-8(14)12(4)6(5-13)7(10)11/h5-7H,1-4H3 |
| InChIKey | ZLVNGCUQJXQKCM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|