C13H22N2O2 — CID 86596606
tert-butyl N-[(E,3S)-1-cyano-4-methylpent-1-en-3-yl]-N-methylcarbamate (PubChem CID 86596606) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is tert-butyl N-[(E,3S)-1-cyano-4-methylpent-1-en-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(E,3S)-1-cyano-4-methylpent-1-en-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86596606 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | tert-butyl N-[(E,3S)-1-cyano-4-methylpent-1-en-3-yl]-N-methylcarbamate |
| SMILES | CC(C)[C@@H](/C=C/C#N)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O2/c1-10(2)11(8-7-9-14)15(6)12(16)17-13(3,4)5/h7-8,10-11H,1-6H3/b8-7+/t11-/m1/s1 |
| InChIKey | NQYRPNUDHNBYBM-WSKFYRRCSA-N |
| XLogP | 2.96 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|