C23H32ClN3O2 — CID 163996100
N-[(6-chloro-5-methoxy-3-pyridinyl)methyl]-2-[(9R)-9-(1,2-dihydropyridin-6-yl)-6-oxaspiro[4.5]decan-9-yl]ethanamine (PubChem CID 163996100) has the molecular formula C23H32ClN3O2 and a molecular weight of 417.98 g/mol. Its IUPAC name is N-[(6-chloro-5-methoxy-3-pyridinyl)methyl]-2-[(9R)-9-(1,2-dihydropyridin-6-yl)-6-oxaspiro[4.5]decan-9-yl]ethanamine.
| Compound Name | N-[(6-chloro-5-methoxy-3-pyridinyl)methyl]-2-[(9R)-9-(1,2-dihydropyridin-6-yl)-6-oxaspiro[4.5]decan-9-yl]ethanamine |
|---|---|
| PubChem CID | 163996100 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[(6-chloro-5-methoxy-3-pyridinyl)methyl]-2-[(9R)-9-(1,2-dihydropyridin-6-yl)-6-oxaspiro[4.5]decan-9-yl]ethanamine |
| SMILES | COc1cc(CNCC[C@@]2(C3=CC=CCN3)CCOC3(CCCC3)C2)cnc1Cl |
| InChI | InChI=1S/C23H32ClN3O2/c1-28-19-14-18(16-27-21(19)24)15-25-12-9-22(20-6-2-5-11-26-20)10-13-29-23(17-22)7-3-4-8-23/h2,5-6,14,16,25-26H,3-4,7-13,15,17H2,1H3/t22-/m1/s1 |
| InChIKey | UEVBEVWUOGBNFL-JOCHJYFZSA-N |
| XLogP | 4.38 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|