About hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate
hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate (PubChem CID 163999504) has the molecular formula C11H14FN3O3
and a molecular weight of 255.25 g/mol. Its IUPAC name is hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
| PubChem CID | 163999504 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
| SMILES | C=CCCCCOC(=O)n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C11H14FN3O3/c1-2-3-4-5-6-18-11(17)15-7-8(12)9(13)14-10(15)16/h2,7H,1,3-6H2,(H2,13,14,16) |
| InChIKey | UHRWQHGJOZVOBN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate?
The IUPAC name of hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate (CID 163999504) is hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate.
What is the SMILES notation for hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate?
The canonical SMILES for hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate is C=CCCCCOC(=O)n1cc(F)c(N)nc1=O.
What is the InChIKey of hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate?
The InChIKey is UHRWQHGJOZVOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN3O3/c1-2-3-4-5-6-18-11(17)15-7-8(12)9(13)14-10(15)16/h2,7H,1,3-6H2,(H2,13,14,16).
What are the key properties of hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate?
hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate has a molecular weight of 255.25 g/mol, XLogP of 1.31, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-enyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate is sourced from PubChem (CID 163999504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).