C10H14FN3O3 — CID 58138326
pentyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate (PubChem CID 58138326) has the molecular formula C10H14FN3O3 and a molecular weight of 243.24 g/mol. Its IUPAC name is pentyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate.
| Compound Name | pentyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 58138326 |
| Molecular Formula | C10H14FN3O3 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | pentyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
| SMILES | CCCCCOC(=O)n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C10H14FN3O3/c1-2-3-4-5-17-10(16)14-6-7(11)8(12)13-9(14)15/h6H,2-5H2,1H3,(H2,12,13,15) |
| InChIKey | WHLGAWVNUAPLCP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|