C7H8FN3O3 — CID 58138315
ethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate (PubChem CID 58138315) has the molecular formula C7H8FN3O3 and a molecular weight of 201.16 g/mol. Its IUPAC name is ethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate.
| Compound Name | ethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 58138315 |
| Molecular Formula | C7H8FN3O3 |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | ethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
| SMILES | CCOC(=O)n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C7H8FN3O3/c1-2-14-7(13)11-3-4(8)5(9)10-6(11)12/h3H,2H2,1H3,(H2,9,10,12) |
| InChIKey | MMNNNCCLKAWPPZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |