C7H5Cl3FN3O3 — CID 58138329
2,2,2-trichloroethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate (PubChem CID 58138329) has the molecular formula C7H5Cl3FN3O3 and a molecular weight of 304.49 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 58138329 |
| Molecular Formula | C7H5Cl3FN3O3 |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 302.94 |
| IUPAC Name | 2,2,2-trichloroethyl 4-amino-5-fluoro-2-oxopyrimidine-1-carboxylate |
| SMILES | Nc1nc(=O)n(C(=O)OCC(Cl)(Cl)Cl)cc1F |
| InChI | InChI=1S/C7H5Cl3FN3O3/c8-7(9,10)2-17-6(16)14-1-3(11)4(12)13-5(14)15/h1H,2H2,(H2,12,13,15) |
| InChIKey | OYUNTCITAQDGGT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|