C11H16FN3O3 — CID 118391654
pentyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate (PubChem CID 118391654) has the molecular formula C11H16FN3O3 and a molecular weight of 257.26 g/mol. Its IUPAC name is pentyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate.
| Compound Name | pentyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 118391654 |
| Molecular Formula | C11H16FN3O3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | pentyl N-(5-fluoro-1-methyl-2-oxopyrimidin-4-yl)carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n(C)cc1F |
| InChI | InChI=1S/C11H16FN3O3/c1-3-4-5-6-18-11(17)14-9-8(12)7-15(2)10(16)13-9/h7H,3-6H2,1-2H3,(H,13,14,16,17) |
| InChIKey | QMCKVMNCZSGBGP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|