C17H28FN3O4 — CID 142440976
butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 142440976) has the molecular formula C17H28FN3O4 and a molecular weight of 357.43 g/mol. Its IUPAC name is butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142440976 |
| Molecular Formula | C17H28FN3O4 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | butyl N-[5-fluoro-1-[(1S)-1-(2-methylbutoxy)propyl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1nc(=O)n([C@H](CC)OCC(C)CC)cc1F |
| InChI | InChI=1S/C17H28FN3O4/c1-5-8-9-24-17(23)20-15-13(18)10-21(16(22)19-15)14(7-3)25-11-12(4)6-2/h10,12,14H,5-9,11H2,1-4H3,(H,19,20,22,23)/t12?,14-/m0/s1 |
| InChIKey | QJNZFIKDPQJHDI-PYMCNQPYSA-N |
| XLogP | 3.70 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|