C16H24FN3O4 — CID 90925582
pentyl N-[1-(4,5-dimethyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate (PubChem CID 90925582) has the molecular formula C16H24FN3O4 and a molecular weight of 341.38 g/mol. Its IUPAC name is pentyl N-[1-(4,5-dimethyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[1-(4,5-dimethyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 90925582 |
| Molecular Formula | C16H24FN3O4 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | pentyl N-[1-(4,5-dimethyloxolan-2-yl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n(C2CC(C)C(C)O2)cc1F |
| InChI | InChI=1S/C16H24FN3O4/c1-4-5-6-7-23-16(22)19-14-12(17)9-20(15(21)18-14)13-8-10(2)11(3)24-13/h9-11,13H,4-8H2,1-3H3,(H,18,19,21,22) |
| InChIKey | SXLXHRKEXFCXII-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|