C20H28FN3O8 — CID 54271655
[(2R,3R,4R,5R)-4-acetyloxy-5-[4-(2-ethylbutoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-2-methyloxolan-3-yl] acetate (PubChem CID 54271655) has the molecular formula C20H28FN3O8 and a molecular weight of 457.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-[4-(2-ethylbutoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-2-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-[4-(2-ethylbutoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-2-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 54271655 |
| Molecular Formula | C20H28FN3O8 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-[4-(2-ethylbutoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-2-methyloxolan-3-yl] acetate |
| SMILES | CCC(CC)COC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](OC(C)=O)[C@H]2OC(C)=O)cc1F |
| InChI | InChI=1S/C20H28FN3O8/c1-6-13(7-2)9-29-20(28)23-17-14(21)8-24(19(27)22-17)18-16(32-12(5)26)15(10(3)30-18)31-11(4)25/h8,10,13,15-16,18H,6-7,9H2,1-5H3,(H,22,23,27,28)/t10-,15-,16-,18-/m1/s1 |
| InChIKey | RKOCPFHNFANGJF-DUBJGWMJSA-N |
| XLogP | 2.15 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|