C12H18FN3O3 — CID 170597258
pentyl N-(1-ethyl-5-fluoro-2-oxopyrimidin-4-yl)carbamate (PubChem CID 170597258) has the molecular formula C12H18FN3O3 and a molecular weight of 271.29 g/mol. Its IUPAC name is pentyl N-(1-ethyl-5-fluoro-2-oxopyrimidin-4-yl)carbamate.
| Compound Name | pentyl N-(1-ethyl-5-fluoro-2-oxopyrimidin-4-yl)carbamate |
|---|---|
| PubChem CID | 170597258 |
| Molecular Formula | C12H18FN3O3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | pentyl N-(1-ethyl-5-fluoro-2-oxopyrimidin-4-yl)carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n(CC)cc1F |
| InChI | InChI=1S/C12H18FN3O3/c1-3-5-6-7-19-12(18)15-10-9(13)8-16(4-2)11(17)14-10/h8H,3-7H2,1-2H3,(H,14,15,17,18) |
| InChIKey | KHPXTDMPNGCKFI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|