C11H14FN3O3 — CID 58166422
ethyl N-[1-(cyclopropylmethyl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate (PubChem CID 58166422) has the molecular formula C11H14FN3O3 and a molecular weight of 255.25 g/mol. Its IUPAC name is ethyl N-[1-(cyclopropylmethyl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | ethyl N-[1-(cyclopropylmethyl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 58166422 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | ethyl N-[1-(cyclopropylmethyl)-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc(=O)n(CC2CC2)cc1F |
| InChI | InChI=1S/C11H14FN3O3/c1-2-18-11(17)14-9-8(12)6-15(10(16)13-9)5-7-3-4-7/h6-7H,2-5H2,1H3,(H,13,14,16,17) |
| InChIKey | IDCDGIXXEVWPTK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |