C16H26FN3O4 — CID 142440981
ethyl N-[5-fluoro-1-[(2S)-2-(2-methylbutoxy)butyl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 142440981) has the molecular formula C16H26FN3O4 and a molecular weight of 343.40 g/mol. Its IUPAC name is ethyl N-[5-fluoro-1-[(2S)-2-(2-methylbutoxy)butyl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | ethyl N-[5-fluoro-1-[(2S)-2-(2-methylbutoxy)butyl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142440981 |
| Molecular Formula | C16H26FN3O4 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | ethyl N-[5-fluoro-1-[(2S)-2-(2-methylbutoxy)butyl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCOC(=O)Nc1nc(=O)n(C[C@H](CC)OCC(C)CC)cc1F |
| InChI | InChI=1S/C16H26FN3O4/c1-5-11(4)10-24-12(6-2)8-20-9-13(17)14(18-15(20)21)19-16(22)23-7-3/h9,11-12H,5-8,10H2,1-4H3,(H,18,19,21,22)/t11?,12-/m0/s1 |
| InChIKey | FEDISGDNTXLAEX-KIYNQFGBSA-N |
| XLogP | 2.79 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |