C8H12FN3O2 — CID 71215793
4-amino-5-fluoro-1-(propoxymethyl)pyrimidin-2-one (PubChem CID 71215793) has the molecular formula C8H12FN3O2 and a molecular weight of 201.20 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-(propoxymethyl)pyrimidin-2-one.
| Compound Name | 4-amino-5-fluoro-1-(propoxymethyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 71215793 |
| Molecular Formula | C8H12FN3O2 |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 4-amino-5-fluoro-1-(propoxymethyl)pyrimidin-2-one |
| SMILES | CCCOCn1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C8H12FN3O2/c1-2-3-14-5-12-4-6(9)7(10)11-8(12)13/h4H,2-3,5H2,1H3,(H2,10,11,13) |
| InChIKey | PZADKIQRCOUZBQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|