C33H59NO8 — CID 164500090
N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhenicosa-4,8,12-trien-2-yl]hexanamide (PubChem CID 164500090) has the molecular formula C33H59NO8 and a molecular weight of 597.83 g/mol. Its IUPAC name is N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhenicosa-4,8,12-trien-2-yl]hexanamide.
| Compound Name | N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhenicosa-4,8,12-trien-2-yl]hexanamide |
|---|---|
| PubChem CID | 164500090 |
| Molecular Formula | C33H59NO8 |
| Molecular Weight | 597.83 g/mol |
| Exact Mass | 597.42 |
| IUPAC Name | N-[(4E,8E,12E)-3-hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhenicosa-4,8,12-trien-2-yl]hexanamide |
| SMILES | CCCCCCCC/C=C/CC/C=C/CC/C=C/C(O)C(COC1OC(CO)C(O)C(O)C1O)NC(=O)CCCCC |
| InChI | InChI=1S/C33H59NO8/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-22-27(36)26(34-29(37)23-20-6-4-2)25-41-33-32(40)31(39)30(38)28(24-35)42-33/h12-13,16-17,21-22,26-28,30-33,35-36,38-40H,3-11,14-15,18-20,23-25H2,1-2H3,(H,34,37)/b13-12+,17-16+,22-21+ |
| InChIKey | ZFODRWHRAYLOGZ-UWTBKSSRSA-N |
| XLogP | 4.21 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|