C41H67NO3 — CID 164500637
(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide (PubChem CID 164500637) has the molecular formula C41H67NO3 and a molecular weight of 621.99 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide |
|---|---|
| PubChem CID | 164500637 |
| Molecular Formula | C41H67NO3 |
| Molecular Weight | 621.99 g/mol |
| Exact Mass | 621.51 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(E)-1,3-dihydroxypentadec-4-en-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC(CO)C(O)/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C41H67NO3/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-41(45)42-39(38-43)40(44)36-34-32-30-28-14-12-10-8-6-4-2/h5,7,11,13,16-17,19-20,22-23,25-26,29,31,34,36,39-40,43-44H,3-4,6,8-10,12,14-15,18,21,24,27-28,30,32-33,35,37-38H2,1-2H3,(H,42,45)/b7-5-,13-11-,17-16-,20-19-,23-22-,26-25-,31-29-,36-34+ |
| InChIKey | ZGPYRLGGBIFMJD-OUEMPGBWSA-N |
| XLogP | 10.73 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.99 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|