C36H68O9 — CID 164500655
[1-octoxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-nonadec-9-enoate (PubChem CID 164500655) has the molecular formula C36H68O9 and a molecular weight of 644.93 g/mol. Its IUPAC name is [1-octoxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-nonadec-9-enoate.
| Compound Name | [1-octoxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-nonadec-9-enoate |
|---|---|
| PubChem CID | 164500655 |
| Molecular Formula | C36H68O9 |
| Molecular Weight | 644.93 g/mol |
| Exact Mass | 644.49 |
| IUPAC Name | [1-octoxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (Z)-nonadec-9-enoate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCC(=O)OC(COCCCCCCCC)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C36H68O9/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-23-25-32(38)44-30(28-42-26-24-22-10-8-6-4-2)29-43-36-35(41)34(40)33(39)31(27-37)45-36/h15-16,30-31,33-37,39-41H,3-14,17-29H2,1-2H3/b16-15- |
| InChIKey | ZGQZADHGMUWXFL-NXVVXOECSA-N |
| XLogP | 6.52 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.93 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|