C35H62O4 — CID 164505576
[1-hydroxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 164505576) has the molecular formula C35H62O4 and a molecular weight of 546.88 g/mol. Its IUPAC name is [1-hydroxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [1-hydroxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 164505576 |
| Molecular Formula | C35H62O4 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.46 |
| IUPAC Name | [1-hydroxy-3-[(Z)-tetradec-9-enoxy]propan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(CO)COCCCCCCCC/C=C\CCCC |
| InChI | InChI=1S/C35H62O4/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-35(37)39-34(32-36)33-38-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h5,7,10-13,17-18,34,36H,3-4,6,8-9,14-16,19-33H2,1-2H3/b7-5-,12-10-,13-11-,18-17- |
| InChIKey | ZQHDJCIEPMERPH-BFOXCHDTSA-N |
| XLogP | 9.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|