C33H55NO5 — CID 164508017
2-[[(8Z,11Z,14Z,17Z)-7-undecanoyloxyicosa-8,11,14,17-tetraenoyl]amino]acetic acid (PubChem CID 164508017) has the molecular formula C33H55NO5 and a molecular weight of 545.81 g/mol. Its IUPAC name is 2-[[(8Z,11Z,14Z,17Z)-7-undecanoyloxyicosa-8,11,14,17-tetraenoyl]amino]acetic acid.
| Compound Name | 2-[[(8Z,11Z,14Z,17Z)-7-undecanoyloxyicosa-8,11,14,17-tetraenoyl]amino]acetic acid |
|---|---|
| PubChem CID | 164508017 |
| Molecular Formula | C33H55NO5 |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 545.41 |
| IUPAC Name | 2-[[(8Z,11Z,14Z,17Z)-7-undecanoyloxyicosa-8,11,14,17-tetraenoyl]amino]acetic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C(CCCCCC(=O)NCC(=O)O)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C33H55NO5/c1-3-5-7-9-11-13-14-15-16-18-21-25-30(26-22-20-23-27-31(35)34-29-32(36)37)39-33(38)28-24-19-17-12-10-8-6-4-2/h5,7,11,13,15-16,21,25,30H,3-4,6,8-10,12,14,17-20,22-24,26-29H2,1-2H3,(H,34,35)(H,36,37)/b7-5-,13-11-,16-15-,25-21- |
| InChIKey | ZVBVFJOWSVQNOU-OTBHYKKQSA-N |
| XLogP | 8.39 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|