C39H61NO3 — CID 164509142
(5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(4E,8E)-1,3-dihydroxytrideca-4,8-dien-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide (PubChem CID 164509142) has the molecular formula C39H61NO3 and a molecular weight of 591.92 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(4E,8E)-1,3-dihydroxytrideca-4,8-dien-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(4E,8E)-1,3-dihydroxytrideca-4,8-dien-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide |
|---|---|
| PubChem CID | 164509142 |
| Molecular Formula | C39H61NO3 |
| Molecular Weight | 591.92 g/mol |
| Exact Mass | 591.47 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z,20Z,23Z)-N-[(4E,8E)-1,3-dihydroxytrideca-4,8-dien-2-yl]hexacosa-5,8,11,14,17,20,23-heptaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC(CO)C(O)/C=C/CC/C=C/CCCC |
| InChI | InChI=1S/C39H61NO3/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-39(43)40-37(36-41)38(42)34-32-30-28-12-10-8-6-4-2/h5,7,10-13,15-16,18-19,21-22,24-25,27,29,32,34,37-38,41-42H,3-4,6,8-9,14,17,20,23,26,28,30-31,33,35-36H2,1-2H3,(H,40,43)/b7-5-,12-10+,13-11-,16-15-,19-18-,22-21-,25-24-,29-27-,34-32+ |
| InChIKey | ZXFKSTQQRXOHFP-RUIVWUOPSA-N |
| XLogP | 9.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.92 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|