2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid

C12H11N3O2 — CID 164510683

IUPAC2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid
SMILESO=C(O)c1cc2n(n1)CC(c1ccccc1)N2
InChIInChI=1S/C12H11N3O2/c16-12(17)9-6-11-13-10(7-15(11)14-9)8-4-2-1-3-5-8/h1-6,10,13H,7H2,(H,16,17)
InChIKeyUQJUKHHPNKCXDH-UHFFFAOYSA-N
MW229.24 g/mol
LogP1.75
Rot. Bonds2

About 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid

2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid (PubChem CID 164510683) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid.

Molecular Properties

Compound Name2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid
PubChem CID164510683
Molecular FormulaC12H11N3O2
Molecular Weight229.24 g/mol
Exact Mass229.09
IUPAC Name2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid
SMILESO=C(O)c1cc2n(n1)CC(c1ccccc1)N2
InChIInChI=1S/C12H11N3O2/c16-12(17)9-6-11-13-10(7-15(11)14-9)8-4-2-1-3-5-8/h1-6,10,13H,7H2,(H,16,17)
InChIKeyUQJUKHHPNKCXDH-UHFFFAOYSA-N
XLogP1.75
TPSA67.15 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.24
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid?
The IUPAC name of 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid (CID 164510683) is 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid.
What is the SMILES notation for 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid?
The canonical SMILES for 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid is O=C(O)c1cc2n(n1)CC(c1ccccc1)N2.
What is the InChIKey of 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid?
The InChIKey is UQJUKHHPNKCXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c16-12(17)9-6-11-13-10(7-15(11)14-9)8-4-2-1-3-5-8/h1-6,10,13H,7H2,(H,16,17).
What are the key properties of 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid?
2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid has a molecular weight of 229.24 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2,3-dihydro-1H-imidazo[2,1-e]pyrazole-6-carboxylic acid is sourced from PubChem (CID 164510683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).