C14H23NO4 — CID 164511129
[(3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,6-dien-4-yl] acetate (PubChem CID 164511129) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is [(3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,6-dien-4-yl] acetate.
| Compound Name | [(3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,6-dien-4-yl] acetate |
|---|---|
| PubChem CID | 164511129 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [(3S,4S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hepta-1,6-dien-4-yl] acetate |
| SMILES | C=CC[C@H](OC(C)=O)[C@H](C=C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO4/c1-7-9-12(18-10(3)16)11(8-2)15-13(17)19-14(4,5)6/h7-8,11-12H,1-2,9H2,3-6H3,(H,15,17)/t11-,12-/m0/s1 |
| InChIKey | FMRKQQUMMUWCLW-RYUDHWBXSA-N |
| XLogP | 2.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|