C12H21NO4 — CID 10399528
ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 10399528) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 10399528 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=CC[C@@H](NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C12H21NO4/c1-6-8-9(10(14)16-7-2)13-11(15)17-12(3,4)5/h6,9H,1,7-8H2,2-5H3,(H,13,15)/t9-/m1/s1 |
| InChIKey | SIRQOZVFCRSBNJ-SECBINFHSA-N |
| XLogP | 2.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|