C15H16F3N3O — CID 164511448
(1Z)-1-(1-methylpyrrolidin-2-ylidene)-3-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]urea (PubChem CID 164511448) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is (1Z)-1-(1-methylpyrrolidin-2-ylidene)-3-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]urea.
| Compound Name | (1Z)-1-(1-methylpyrrolidin-2-ylidene)-3-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]urea |
|---|---|
| PubChem CID | 164511448 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (1Z)-1-(1-methylpyrrolidin-2-ylidene)-3-[(E)-2-[3-(trifluoromethyl)phenyl]ethenyl]urea |
| SMILES | CN1CCC/C1=N/C(=O)N/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3N3O/c1-21-9-3-6-13(21)20-14(22)19-8-7-11-4-2-5-12(10-11)15(16,17)18/h2,4-5,7-8,10H,3,6,9H2,1H3,(H,19,22)/b8-7+,20-13- |
| InChIKey | GTXIXODVVCLWSX-VQZJWSCISA-N |
| XLogP | 3.51 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|