C21H15N3OS — CID 164513125
2-[2-(4-methoxyphenyl)-3H-benzimidazol-5-yl]-1,3-benzothiazole (PubChem CID 164513125) has the molecular formula C21H15N3OS and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-3H-benzimidazol-5-yl]-1,3-benzothiazole.
| Compound Name | 2-[2-(4-methoxyphenyl)-3H-benzimidazol-5-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 164513125 |
| Molecular Formula | C21H15N3OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-3H-benzimidazol-5-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(-c2nc3ccc(-c4nc5ccccc5s4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C21H15N3OS/c1-25-15-9-6-13(7-10-15)20-22-16-11-8-14(12-18(16)23-20)21-24-17-4-2-3-5-19(17)26-21/h2-12H,1H3,(H,22,23) |
| InChIKey | AOJISDQKZIAZMT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |