C29H32FN7O2 — CID 164514644
6-fluoro-2-N-(6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514644) has the molecular formula C29H32FN7O2 and a molecular weight of 529.62 g/mol. Its IUPAC name is 6-fluoro-2-N-(6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-2-N-(6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514644 |
| Molecular Formula | C29H32FN7O2 |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 6-fluoro-2-N-(6-methoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | COc1cc2c(cc1Nc1ncc3c(N)c(F)c(-c4cnc5c(c4C)NCCO5)cc3n1)C(C)N(C)C(C)C2 |
| InChI | InChI=1S/C29H32FN7O2/c1-14-8-17-9-24(38-5)23(10-18(17)16(3)37(14)4)36-29-34-13-21-22(35-29)11-19(25(30)26(21)31)20-12-33-28-27(15(20)2)32-6-7-39-28/h9-14,16,32H,6-8,31H2,1-5H3,(H,34,35,36) |
| InChIKey | OCTCNXWJHCTXBH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 110.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|