C25H25FN8O — CID 164514727
6-fluoro-2-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514727) has the molecular formula C25H25FN8O and a molecular weight of 472.53 g/mol. Its IUPAC name is 6-fluoro-2-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-2-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514727 |
| Molecular Formula | C25H25FN8O |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 6-fluoro-2-N-(6-methyl-7,8-dihydro-5H-1,6-naphthyridin-3-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4cnc5c(c4)CN(C)CC5)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C25H25FN8O/c1-13-17(10-30-24-23(13)28-4-6-35-24)16-8-20-18(22(27)21(16)26)11-31-25(33-20)32-15-7-14-12-34(2)5-3-19(14)29-9-15/h7-11,28H,3-6,12,27H2,1-2H3,(H,31,32,33) |
| InChIKey | DVQQZSYPSMNOCG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 114.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|