C26H25F2N7O — CID 164514649
6-fluoro-2-N-(6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine (PubChem CID 164514649) has the molecular formula C26H25F2N7O and a molecular weight of 489.53 g/mol. Its IUPAC name is 6-fluoro-2-N-(6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 6-fluoro-2-N-(6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 164514649 |
| Molecular Formula | C26H25F2N7O |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 6-fluoro-2-N-(6-fluoro-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)-7-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)quinazoline-2,5-diamine |
| SMILES | Cc1c(-c2cc3nc(Nc4cc5c(cc4F)CCN(C)C5)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C26H25F2N7O/c1-13-17(10-31-25-24(13)30-4-6-36-25)16-9-20-18(23(29)22(16)28)11-32-26(33-20)34-21-8-15-12-35(2)5-3-14(15)7-19(21)27/h7-11,30H,3-6,12,29H2,1-2H3,(H,32,33,34) |
| InChIKey | ZCBWHLOLNBNXEX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|