About 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile
4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile (PubChem CID 164517399) has the molecular formula C18H12N2O4
and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile |
| PubChem CID | 164517399 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile |
| SMILES | CC(=O)c1ccc2oc(=O)n(Cc3ccc(C#N)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C18H12N2O4/c1-11(21)14-6-7-16-15(8-14)17(22)20(18(23)24-16)10-13-4-2-12(9-19)3-5-13/h2-8H,10H2,1H3 |
| InChIKey | QVHVYSMQTVYQES-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile?
The IUPAC name of 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile (CID 164517399) is 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile.
What is the SMILES notation for 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile?
The canonical SMILES for 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile is CC(=O)c1ccc2oc(=O)n(Cc3ccc(C#N)cc3)c(=O)c2c1.
What is the InChIKey of 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile?
The InChIKey is QVHVYSMQTVYQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O4/c1-11(21)14-6-7-16-15(8-14)17(22)20(18(23)24-16)10-13-4-2-12(9-19)3-5-13/h2-8H,10H2,1H3.
What are the key properties of 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile?
4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile has a molecular weight of 320.30 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-acetyl-2,4-dioxo-1,3-benzoxazin-3-yl)methyl]benzonitrile is sourced from PubChem (CID 164517399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).