About 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride
5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride (PubChem CID 164517810) has the molecular formula C10H17ClN2O2
and a molecular weight of 232.71 g/mol. Its IUPAC name is 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride |
| PubChem CID | 164517810 |
| Molecular Formula | C10H17ClN2O2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride |
| SMILES | Cc1cc(COC2CCNCC2)no1.Cl |
| InChI | InChI=1S/C10H16N2O2.ClH/c1-8-6-9(12-14-8)7-13-10-2-4-11-5-3-10;/h6,10-11H,2-5,7H2,1H3;1H |
| InChIKey | LSXBNNZUFZXGKN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride?
The IUPAC name of 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride (CID 164517810) is 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride.
What is the SMILES notation for 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride?
The canonical SMILES for 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride is Cc1cc(COC2CCNCC2)no1.Cl.
What is the InChIKey of 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride?
The InChIKey is LSXBNNZUFZXGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2.ClH/c1-8-6-9(12-14-8)7-13-10-2-4-11-5-3-10;/h6,10-11H,2-5,7H2,1H3;1H.
What are the key properties of 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride?
5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride has a molecular weight of 232.71 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(piperidin-4-yloxymethyl)-1,2-oxazole;hydrochloride is sourced from PubChem (CID 164517810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).