C21H27N3O4 — CID 177372094
4-[(5-methyl-1,2-oxazol-3-yl)methyl]-7-(3-piperidin-4-yloxypropyl)-1,4-benzoxazin-3-one (PubChem CID 177372094) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[(5-methyl-1,2-oxazol-3-yl)methyl]-7-(3-piperidin-4-yloxypropyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-[(5-methyl-1,2-oxazol-3-yl)methyl]-7-(3-piperidin-4-yloxypropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 177372094 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-[(5-methyl-1,2-oxazol-3-yl)methyl]-7-(3-piperidin-4-yloxypropyl)-1,4-benzoxazin-3-one |
| SMILES | Cc1cc(CN2C(=O)COc3cc(CCCOC4CCNCC4)ccc32)no1 |
| InChI | InChI=1S/C21H27N3O4/c1-15-11-17(23-28-15)13-24-19-5-4-16(12-20(19)27-14-21(24)25)3-2-10-26-18-6-8-22-9-7-18/h4-5,11-12,18,22H,2-3,6-10,13-14H2,1H3 |
| InChIKey | IBJBISFRHZNHQQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|