C33H46N2O6 — CID 68503173
6-[[4-[4-(3-cyclohexyloxypropoxy)phenyl]piperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-1,4-benzoxazin-3-one (PubChem CID 68503173) has the molecular formula C33H46N2O6 and a molecular weight of 566.74 g/mol. Its IUPAC name is 6-[[4-[4-(3-cyclohexyloxypropoxy)phenyl]piperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-[[4-[4-(3-cyclohexyloxypropoxy)phenyl]piperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 68503173 |
| Molecular Formula | C33H46N2O6 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | 6-[[4-[4-(3-cyclohexyloxypropoxy)phenyl]piperidin-3-yl]oxymethyl]-4-(3-methoxypropyl)-1,4-benzoxazin-3-one |
| SMILES | COCCCN1C(=O)COc2ccc(COC3CNCCC3c3ccc(OCCCOC4CCCCC4)cc3)cc21 |
| InChI | InChI=1S/C33H46N2O6/c1-37-18-5-17-35-30-21-25(9-14-31(30)41-24-33(35)36)23-40-32-22-34-16-15-29(32)26-10-12-28(13-11-26)39-20-6-19-38-27-7-3-2-4-8-27/h9-14,21,27,29,32,34H,2-8,15-20,22-24H2,1H3 |
| InChIKey | OGSYAIBTMWAIKQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|