C34H41ClN2O5 — CID 59457338
7-[[(3R,4R)-4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)-3,4-dihydroquinolin-2-one (PubChem CID 59457338) has the molecular formula C34H41ClN2O5 and a molecular weight of 593.16 g/mol. Its IUPAC name is 7-[[(3R,4R)-4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 7-[[(3R,4R)-4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 59457338 |
| Molecular Formula | C34H41ClN2O5 |
| Molecular Weight | 593.16 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | 7-[[(3R,4R)-4-[4-[3-(2-chlorophenoxy)propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)-3,4-dihydroquinolin-2-one |
| SMILES | COCCCN1C(=O)CCc2ccc(CO[C@H]3CNCC[C@@H]3c3ccc(OCCCOc4ccccc4Cl)cc3)cc21 |
| InChI | InChI=1S/C34H41ClN2O5/c1-39-19-4-18-37-31-22-25(8-9-27(31)12-15-34(37)38)24-42-33-23-36-17-16-29(33)26-10-13-28(14-11-26)40-20-5-21-41-32-7-3-2-6-30(32)35/h2-3,6-11,13-14,22,29,33,36H,4-5,12,15-21,23-24H2,1H3/t29-,33+/m1/s1 |
| InChIKey | RPMABISXTNPEHK-CPBHLAHYSA-N |
| XLogP | 6.17 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.16 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|