C29H36N2O6 — CID 68501130
3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylic acid (PubChem CID 68501130) has the molecular formula C29H36N2O6 and a molecular weight of 508.62 g/mol. Its IUPAC name is 3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylic acid.
| Compound Name | 3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68501130 |
| Molecular Formula | C29H36N2O6 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]-4-(4-prop-2-enoxyphenyl)piperidine-1-carboxylic acid |
| SMILES | C=CCOc1ccc(C2CCN(C(=O)O)CC2OCc2ccc3c(c2)N(CCCOC)C(=O)CC3)cc1 |
| InChI | InChI=1S/C29H36N2O6/c1-3-16-36-24-10-7-22(8-11-24)25-13-15-30(29(33)34)19-27(25)37-20-21-5-6-23-9-12-28(32)31(26(23)18-21)14-4-17-35-2/h3,5-8,10-11,18,25,27H,1,4,9,12-17,19-20H2,2H3,(H,33,34) |
| InChIKey | COCAUEMJZPQLSL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|