C33H38N2O6 — CID 68502032
benzyl 4-(4-hydroxyphenyl)-3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]piperidine-1-carboxylate (PubChem CID 68502032) has the molecular formula C33H38N2O6 and a molecular weight of 558.68 g/mol. Its IUPAC name is benzyl 4-(4-hydroxyphenyl)-3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | benzyl 4-(4-hydroxyphenyl)-3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68502032 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | benzyl 4-(4-hydroxyphenyl)-3-[[1-(3-methoxypropyl)-2-oxo-3,4-dihydroquinolin-7-yl]methoxy]piperidine-1-carboxylate |
| SMILES | COCCCN1C(=O)CCc2ccc(COC3CN(C(=O)OCc4ccccc4)CCC3c3ccc(O)cc3)cc21 |
| InChI | InChI=1S/C33H38N2O6/c1-39-19-5-17-35-30-20-25(8-9-27(30)12-15-32(35)37)23-40-31-21-34(33(38)41-22-24-6-3-2-4-7-24)18-16-29(31)26-10-13-28(36)14-11-26/h2-4,6-11,13-14,20,29,31,36H,5,12,15-19,21-23H2,1H3 |
| InChIKey | MPGUEYGTCJKZMZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|