C29H39N3O5 — CID 91606980
3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxylic acid (PubChem CID 91606980) has the molecular formula C29H39N3O5 and a molecular weight of 509.65 g/mol. Its IUPAC name is 3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxylic acid.
| Compound Name | 3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 91606980 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-pyrrolidin-1-ylphenyl)piperidine-1-carboxylic acid |
| SMILES | COCCCN1CCOc2ccc(COC3CN(C(=O)O)CCC3c3ccc(N4CCCC4)cc3)cc21 |
| InChI | InChI=1S/C29H39N3O5/c1-35-17-4-14-31-16-18-36-27-10-5-22(19-26(27)31)21-37-28-20-32(29(33)34)15-11-25(28)23-6-8-24(9-7-23)30-12-2-3-13-30/h5-10,19,25,28H,2-4,11-18,20-21H2,1H3,(H,33,34) |
| InChIKey | CLAKOYCXERIDOK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|