C27H32N4O6 — CID 90978338
4-[4-(2-diazoacetyl)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid (PubChem CID 90978338) has the molecular formula C27H32N4O6 and a molecular weight of 508.58 g/mol. Its IUPAC name is 4-[4-(2-diazoacetyl)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-(2-diazoacetyl)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90978338 |
| Molecular Formula | C27H32N4O6 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 4-[4-(2-diazoacetyl)phenyl]-3-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylic acid |
| SMILES | COCCCN1CCOc2ccc(COC3CN(C(=O)O)CCC3c3ccc(C(=O)C=[N+]=[N-])cc3)cc21 |
| InChI | InChI=1S/C27H32N4O6/c1-35-13-2-10-30-12-14-36-25-8-3-19(15-23(25)30)18-37-26-17-31(27(33)34)11-9-22(26)20-4-6-21(7-5-20)24(32)16-29-28/h3-8,15-16,22,26H,2,9-14,17-18H2,1H3,(H,33,34) |
| InChIKey | APZYSHQTSAWVGM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|