C35H40N4O7 — CID 91136035
benzyl (2S,4R,5R)-2-(2-diazoacetyl)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate (PubChem CID 91136035) has the molecular formula C35H40N4O7 and a molecular weight of 628.73 g/mol. Its IUPAC name is benzyl (2S,4R,5R)-2-(2-diazoacetyl)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | benzyl (2S,4R,5R)-2-(2-diazoacetyl)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91136035 |
| Molecular Formula | C35H40N4O7 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | benzyl (2S,4R,5R)-2-(2-diazoacetyl)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidine-1-carboxylate |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN(C(=O)OCc4ccccc4)[C@H](C(=O)C=[N+]=[N-])C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C35H40N4O7/c1-42-17-6-15-38-16-18-44-33-14-9-26(19-31(33)38)24-45-34-22-39(35(41)46-23-25-7-4-3-5-8-25)30(32(40)21-37-36)20-29(34)27-10-12-28(43-2)13-11-27/h3-5,7-14,19,21,29-30,34H,6,15-18,20,22-24H2,1-2H3/t29-,30+,34+/m1/s1 |
| InChIKey | YZLVEZRDOHLPRC-CRBXJKDESA-N |
| XLogP | 4.88 |
| TPSA | 123.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|