C35H44N2O5 — CID 59176164
3-[(1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N-phenylpropanamide (PubChem CID 59176164) has the molecular formula C35H44N2O5 and a molecular weight of 572.75 g/mol. Its IUPAC name is 3-[(1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N-phenylpropanamide.
| Compound Name | 3-[(1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 59176164 |
| Molecular Formula | C35H44N2O5 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 3-[(1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-N-phenylpropanamide |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CC[C@H](CCC(=O)Nc4ccccc4)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C35H44N2O5/c1-39-21-6-19-37-20-22-41-34-17-10-27(24-32(34)37)25-42-33-16-9-26(11-18-35(38)36-29-7-4-3-5-8-29)23-31(33)28-12-14-30(40-2)15-13-28/h3-5,7-8,10,12-15,17,24,26,31,33H,6,9,11,16,18-23,25H2,1-2H3,(H,36,38)/t26-,31-,33+/m1/s1 |
| InChIKey | QDDUZCZKSFTWPZ-UGUZWBSBSA-N |
| XLogP | 6.82 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|