C33H48N2O6 — CID 59176178
[1-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2-methylpropan-2-yl] N,N-dimethylcarbamate (PubChem CID 59176178) has the molecular formula C33H48N2O6 and a molecular weight of 568.76 g/mol. Its IUPAC name is [1-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2-methylpropan-2-yl] N,N-dimethylcarbamate.
| Compound Name | [1-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2-methylpropan-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 59176178 |
| Molecular Formula | C33H48N2O6 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | [1-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2-methylpropan-2-yl] N,N-dimethylcarbamate |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CC[C@H](CC(C)(C)OC(=O)N(C)C)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C33H48N2O6/c1-33(2,41-32(36)34(3)4)22-24-8-14-30(28(20-24)26-10-12-27(38-6)13-11-26)40-23-25-9-15-31-29(21-25)35(17-19-39-31)16-7-18-37-5/h9-13,15,21,24,28,30H,7-8,14,16-20,22-23H2,1-6H3/t24-,28+,30-/m0/s1 |
| InChIKey | WDABRYZAXOYQDO-XGSJXSIHSA-N |
| XLogP | 6.27 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|