C30H42N2O6 — CID 68686495
3-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanoic acid (PubChem CID 68686495) has the molecular formula C30H42N2O6 and a molecular weight of 526.67 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 68686495 |
| Molecular Formula | C30H42N2O6 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | 3-[(2R,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanoic acid |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN[C@@H](CC(C)(C)C(=O)O)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C30H42N2O6/c1-30(2,29(33)34)18-23-17-25(22-7-9-24(36-4)10-8-22)28(19-31-23)38-20-21-6-11-27-26(16-21)32(13-15-37-27)12-5-14-35-3/h6-11,16,23,25,28,31H,5,12-15,17-20H2,1-4H3,(H,33,34)/t23-,25-,28+/m1/s1 |
| InChIKey | WUVFLRICVBHGKN-LOLUNWTRSA-N |
| XLogP | 4.46 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|