C33H49N3O6 — CID 71122102
N-(2-methoxyethyl)-3-[(2S,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide (PubChem CID 71122102) has the molecular formula C33H49N3O6 and a molecular weight of 583.77 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[(2S,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-(2-methoxyethyl)-3-[(2S,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71122102 |
| Molecular Formula | C33H49N3O6 |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | N-(2-methoxyethyl)-3-[(2S,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN[C@H](CC(C)(C)C(=O)NCCOC)CC3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C33H49N3O6/c1-33(2,32(37)34-13-17-39-4)21-26-20-28(25-8-10-27(40-5)11-9-25)31(22-35-26)42-23-24-7-12-30-29(19-24)36(15-18-41-30)14-6-16-38-3/h7-12,19,26,28,31,35H,6,13-18,20-23H2,1-5H3,(H,34,37)/t26-,28?,31-/m0/s1 |
| InChIKey | JZCKKCLLNOHYQD-MUDMQIFWSA-N |
| XLogP | 4.14 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|