C27H43N3O4 — CID 23628181
N-(cyclopropylmethyl)-3-[(2S,5R)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide (PubChem CID 23628181) has the molecular formula C27H43N3O4 and a molecular weight of 473.66 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-[(2S,5R)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-(cyclopropylmethyl)-3-[(2S,5R)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 23628181 |
| Molecular Formula | C27H43N3O4 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | N-(cyclopropylmethyl)-3-[(2S,5R)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-2,2-dimethylpropanamide |
| SMILES | COCCCN1CCOc2ccc(CO[C@@H]3CC[C@@H](CC(C)(C)C(=O)NCC4CC4)NC3)cc21 |
| InChI | InChI=1S/C27H43N3O4/c1-27(2,26(31)29-17-20-5-6-20)16-22-8-9-23(18-28-22)34-19-21-7-10-25-24(15-21)30(12-14-33-25)11-4-13-32-3/h7,10,15,20,22-23,28H,4-6,8-9,11-14,16-19H2,1-3H3,(H,29,31)/t22-,23+/m0/s1 |
| InChIKey | WAZFDSOGBYKYAE-XZOQPEGZSA-N |
| XLogP | 3.50 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|