C34H51N3O6 — CID 69128029
3-[(2R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-N,2,2-trimethylpropanamide (PubChem CID 69128029) has the molecular formula C34H51N3O6 and a molecular weight of 597.80 g/mol. Its IUPAC name is 3-[(2R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(2R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 69128029 |
| Molecular Formula | C34H51N3O6 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | 3-[(2R,5R)-4-[4-(2-methoxyethoxymethyl)phenyl]-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)C[C@H]1CC(c2ccc(COCCOC)cc2)[C@@H](OCc2ccc3c(c2)N(CCCOC)CCO3)CN1 |
| InChI | InChI=1S/C34H51N3O6/c1-34(2,33(38)35-3)21-28-20-29(27-10-7-25(8-11-27)23-41-18-17-40-5)32(22-36-28)43-24-26-9-12-31-30(19-26)37(14-16-42-31)13-6-15-39-4/h7-12,19,28-29,32,36H,6,13-18,20-24H2,1-5H3,(H,35,38)/t28-,29?,32+/m1/s1 |
| InChIKey | ICXKFIVABOQKJV-ZDFLVKIYSA-N |
| XLogP | 4.28 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|